Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | GSK2982772 is a potent, orally active and ATP competitive RIP1 kinase inhibitor with IC50 values of 16 nM and 20 nM for human and monkey RIP1, respectively. |
|---|
| Catalog Num | A19380 |
|---|---|
| Formula | C20H19N5O3 |
| Molecular Weight | 377.4 |
| CAS Number | 1622848-92-3 |
| SMILES | O=C(C1=NC(CC2=CC=CC=C2)=NN1)N[C@H]3COC4=CC=CC=C4N(C)C3=O |
| Synonyms | GSK 2982772, GSK 2982772 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 66 mg/mL (174.87 mM) | |
| Water | Insoluble | ||
| Ethanol | 26 mg/mL (68.89 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 26.5 mL | 132.49 mL | 264.97 mL |
| 0.5 mM | 5.3 mL | 26.5 mL | 52.99 mL |
| 1 mM | 2.65 mL | 13.25 mL | 26.5 mL |
| 5 mM | 0.53 mL | 2.65 mL | 5.3 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
