Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | HAMNO, also known as NSC-111847, is a potent and selective inhibitor of replication protein A (RPA) interactions with proteins involved in the replication stress response. |
|---|
| Catalog Num | A17054 |
|---|---|
| Formula | C17H13NO2 |
| Molecular Weight | 263.29 |
| CAS Number | 138736-73-9 |
| SMILES | O=C(C=CC1=C/2C=CC=C1)C2=C/NC3=CC=CC=C3O |
| Synonyms | NSC111847, NSC-111847, NSC 111847 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 49 mg/mL (186.1 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.98 mL | 189.9 mL | 379.81 mL |
| 0.5 mM | 7.6 mL | 37.98 mL | 75.96 mL |
| 1 mM | 3.8 mL | 18.99 mL | 37.98 mL |
| 5 mM | 0.76 mL | 3.8 mL | 7.6 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
