Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | HDAC-IN-3 is a histone deacetylase (HDAC) inhibitor, extracted from patent WO/2008040934 A1. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A20785 |
|---|---|
| Formula | C22H33N3O4 |
| Molecular Weight | 403.52 |
| CAS Number | 1018673-42-1 |
| SMILES | O=C([C@@H](NCC1=CN=C(CCC(NO)=O)C=C1)C2CCCCC2)OC3CCCC3 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 73 mg/mL (180.9 mM) | |
| Water | Insoluble | ||
| Ethanol | 14 mg/mL (34.69 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.78 mL | 123.91 mL | 247.82 mL |
| 0.5 mM | 4.96 mL | 24.78 mL | 49.56 mL |
| 1 mM | 2.48 mL | 12.39 mL | 24.78 mL |
| 5 mM | 0.5 mL | 2.48 mL | 4.96 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
