Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | Hyperoside protects against peroxide-induced oxidative damage to cells by scavenging reactive oxygen species and enhancing activity of anti-oxidant enzymes, in particular, catalase and glutathione peroxidase. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A12070 |
|---|---|
| Formula | C21H20O12 |
| Molecular Weight | 464.38 |
| CAS Number | 482-36-0 |
| SMILES | C1=CC(=C(C=C1C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O[C@H]4[C@@H]([C@H]([C@H]([C@H](O4)CO)O)O)O)O)O |
| Synonyms | Hyperin, Hyperoside, Quercetin 3-D-galactoside |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 91 mg/mL (195.96 mM) | |
| Water | 1 mg/mL (2.15 mM) | ||
| Ethanol | 1 mg/mL (2.15 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.53 mL | 107.67 mL | 215.34 mL |
| 0.5 mM | 4.31 mL | 21.53 mL | 43.07 mL |
| 1 mM | 2.15 mL | 10.77 mL | 21.53 mL |
| 5 mM | 0.43 mL | 2.15 mL | 4.31 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
