Loading distributor info...
| Description | Ibandronate sodium is a highly potent nitrogen-containing bisphosphonate used for the treatment of osteoporosis. |
|---|
| Catalog Num | A11870 |
|---|---|
| Formula | C9H22O7NP2Na.H2O |
| Molecular Weight | 359.2 |
| CAS Number | 138926-19-9 |
| SMILES | OC(P(O)(O)=O)(P(O)(O[Na])=O)CCN(C)CCCCC.O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | 63 mg/mL (174.89 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.84 mL | 139.2 mL | 278.4 mL |
| 0.5 mM | 5.57 mL | 27.84 mL | 55.68 mL |
| 1 mM | 2.78 mL | 13.92 mL | 27.84 mL |
| 5 mM | 0.56 mL | 2.78 mL | 5.57 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
