Loading distributor info...
| Description | IFN-γ Antagonist 1 (AYCRDGKIGPPKLDIRKEEKQI) functions as an antagonist of interferon-γ (IFN-γ). This compound effectively inhibits IFN-γ-induced HLR/DR antigen expression in cellular models. Its application is particularly relevant in the investigation of diseases characterized by dysregulation of immune responses. |
|---|
| Catalog Num | A64839 |
|---|---|
| Formula | C115H194N34O34S |
| Molecular Weight | 2629.04 |
| CAS Number | 158040-83-6 |
| Sequence | Ala-Tyr-{Cys(Acm)}-Arg-Asp-Gly-Lys-Ile-Gly-Pro-Pro-Lys-Leu-{α-Asp}-Ile-Arg-Lys-{α-Glu}-{α-Glu}-Lys-Gln-Ile |
| Sequence shortening | AY-{C |
| SMILES | CC[C@H](C)[C@H](NC(=O)[C@H](CCC(N)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCC(O)=O)NC(=O)[C@H](CCCCN)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@@H](NC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CC(C)C)NC(=O)[C@H](CCCCN)NC(=O)[C@@H]1CCCN1C(=O)[C@@H]1CCCN1C(=O)CNC(=O)[C@@H](NC(=O)[C@H](CCCCN)NC(=O)CNC(=O)[C@H](CC(O)=O)NC(=O)[C@H](CCCNC(N)=N)NC(=O)[C@H](CSCNC(C)=O)NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@H](C)N)[C@@H](C)CC)[C@@H](C)CC)C(O)=O |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
