Loading distributor info...
| Description | IMR-1 is a novel class of Notch inhibitors targeting the transcriptional activation with IC50 of 6 umol/L. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16152 |
|---|---|
| Formula | C15H15NO5S2 |
| Molecular Weight | 353.41 |
| CAS Number | 310456-65-6 |
| SMILES | O=C(OCC)COC1=CC=C(/C=C(SC(N2)=S)C2=O)C=C1OC |
| Synonyms | IMR1, IMR 1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 69 mg/mL (195.24 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.3 mL | 141.48 mL | 282.96 mL |
| 0.5 mM | 5.66 mL | 28.3 mL | 56.59 mL |
| 1 mM | 2.83 mL | 14.15 mL | 28.3 mL |
| 5 mM | 0.57 mL | 2.83 mL | 5.66 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
