Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Indacaterol (QAB149) maleate is an ultra-long-acting β-adrenoceptor agonist. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A16585 |
|---|---|
| Formula | C28H32N2O7 |
| Molecular Weight | 508.56 |
| CAS Number | 753498-25-8 |
| SMILES | O=C1NC2=C(C([C@@H](O)CNC3CC4=C(C=C(CC)C(CC)=C4)C3)=CC=C2O)C=C1.O=C(O)/C=C\C(O)=O |
| Synonyms | QAB149 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 88 mg/mL (173.03 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 4% DMSO+30% PEG 300+ddH2O | 9 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.66 mL | 98.32 mL | 196.63 mL |
| 0.5 mM | 3.93 mL | 19.66 mL | 39.33 mL |
| 1 mM | 1.97 mL | 9.83 mL | 19.66 mL |
| 5 mM | 0.39 mL | 1.97 mL | 3.93 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
