Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Isobavachalcone (Corylifolinin) is derived from Psoralea corylifolia Linn. and is a potent inhibitor of Akt signaling pathway, which induces apoptosis in human cancer cells (Inhibits OVCAR-8 cell growth with an IC50 value of 7.92 μM). | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A11453 |
|---|---|
| Formula | C20H20O4 |
| Molecular Weight | 324.37 |
| CAS Number | 20784-50-3 |
| SMILES | O=C(/C=C/C1=CC=C(C=C1)O)C2=CC=C(C(C/C=C(C)\C)=C2O)O |
| Synonyms | Corylifolinin; Isobacachalcone |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (172.64 mM) | |
| Water | Insoluble | ||
| Ethanol | 56 mg/mL (172.64 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.83 mL | 154.14 mL | 308.29 mL |
| 0.5 mM | 6.17 mL | 30.83 mL | 61.66 mL |
| 1 mM | 3.08 mL | 15.41 mL | 30.83 mL |
| 5 mM | 0.62 mL | 3.08 mL | 6.17 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
