Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | IWP-2 is an inactivator of Porcn function and inhibitor of Wnt production, and blocks beta-catenin accumulation. Wnt/b-catenin ('canonical') pathway maintains transcriptional programs that enable stem cells to remain multipotent. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12707 |
|---|---|
| Formula | C22H18N4O2S3 |
| Molecular Weight | 466.6 |
| CAS Number | 686770-61-6 |
| SMILES | CC1=CC2=C(C=C1)N=C(S2)NC(=O)CSC3=NC4=C(C(=O)N3C5=CC=CC=C5)SCC4 |
| Synonyms | IWP 2,IWP2 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Insoluble | |
| Water | Insoluble | ||
| Ethanol | DMF: 24mg/mL (51.44 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.43 mL | 107.16 mL | 214.32 mL |
| 0.5 mM | 4.29 mL | 21.43 mL | 42.86 mL |
| 1 mM | 2.14 mL | 10.72 mL | 21.43 mL |
| 5 mM | 0.43 mL | 2.14 mL | 4.29 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
