Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | JNJ-42153605 is a positive allosteric modulator of the metabotropic glutamate 2 receptor. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14330 |
|---|---|
| Formula | C22H23F3N4 |
| Molecular Weight | 400.187 |
| CAS Number | 1254977-87-1 |
| SMILES | FC(c1c(ccn2c1nnc2CC1CC1)N1CCC(CC1)c1ccccc1)(F)F |
| Synonyms | JNJ-42153605, JNJ42153605 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 4 mg/mL (9.98 mM) | |
| Water | Insoluble | ||
| Ethanol | 10 mg/mL (24.97 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.99 mL | 124.94 mL | 249.88 mL |
| 0.5 mM | 5 mL | 24.99 mL | 49.98 mL |
| 1 mM | 2.5 mL | 12.49 mL | 24.99 mL |
| 5 mM | 0.5 mL | 2.5 mL | 5 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
