Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | JTC-801 is a selective antagonist for the nociceptin receptor, also known as the ORL-1 receptor. |
|---|
| Catalog Num | A11076 |
|---|---|
| Formula | C26H25N3O2.HCl |
| Molecular Weight | 448 |
| CAS Number | 244218-51-7 |
| SMILES | CCC1=CC=C(C=C1)OCC2=CC=CC=C2C(=O)NC3=CC4=C(C=C3)N=C(C=C4N)C.Cl |
| Synonyms | JTC801 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 88 mg/mL (196.45 mM) | |
| Water | Insoluble | ||
| Ethanol | 30 mg/mL (66.97 mM) | ||
| In vivo | 0.5% methylcellulose | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.32 mL | 111.61 mL | 223.21 mL |
| 0.5 mM | 4.46 mL | 22.32 mL | 44.64 mL |
| 1 mM | 2.23 mL | 11.16 mL | 22.32 mL |
| 5 mM | 0.45 mL | 2.23 mL | 4.46 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
