Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | JTT-705 (Dalcetrapib) is a CETP inhibitor.Inhibition of CETP is a target to increase HDL-cholesterol and potentially reduce atherosclerosis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11213 |
|---|---|
| Formula | C23H35NO2S |
| Molecular Weight | 389.6 |
| CAS Number | 211513-37-0 |
| SMILES | CCC(CC)CC1(CCCCC1)C(=O)NC2=CC=CC=C2SC(=O)C(C)C |
| Synonyms | JTT705 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 66 mg/mL (169.41 mM) | |
| Water | Insoluble | ||
| Ethanol | 66 mg/mL (169.41 mM) | ||
| In vivo | 0.5% methylcellulose | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.67 mL | 128.34 mL | 256.67 mL |
| 0.5 mM | 5.13 mL | 25.67 mL | 51.33 mL |
| 1 mM | 2.57 mL | 12.83 mL | 25.67 mL |
| 5 mM | 0.51 mL | 2.57 mL | 5.13 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
