Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | KAN0438757 is a potent and selective inhibitor of the metabolic kinase PFKFB3 with an IC50 of 0.19 μM . |
|---|
| Catalog Num | A19216 |
|---|---|
| Formula | C21H18FNO7S |
| Molecular Weight | 447.43 |
| CAS Number | 1451255-59-6 |
| SMILES | O=C(OCCO)C1=CC=C(NS(=O)(C2=CC(C3=CC(F)=CC=C3O)=CC=C2)=O)C=C1O |
| Synonyms | KAN 0438757, KAN-0438757 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 6 mg/mL (13.41 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.35 mL | 111.75 mL | 223.5 mL |
| 0.5 mM | 4.47 mL | 22.35 mL | 44.7 mL |
| 1 mM | 2.23 mL | 11.17 mL | 22.35 mL |
| 5 mM | 0.45 mL | 2.23 mL | 4.47 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
