Signaling Pathway
CID797718 analog
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | kb-NB77-78 is an analogue of CID797718, but shows no PKD inhibitory activity. |
|---|
| Catalog Num | A22043 |
|---|---|
| Formula | C18H25NO3Si |
| Molecular Weight | 331.48 |
| CAS Number | 1350622-33-1 |
| SMILES | O=C1OC2=CC=C(O[Si](C)(C(C)(C)C)C)C=C2C3=C1NCCC3 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 61 mg/mL (184.02 mM) | |
| Water | Insoluble | ||
| Ethanol | 61 mg/mL (184.02 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.17 mL | 150.84 mL | 301.68 mL |
| 0.5 mM | 6.03 mL | 30.17 mL | 60.34 mL |
| 1 mM | 3.02 mL | 15.08 mL | 30.17 mL |
| 5 mM | 0.6 mL | 3.02 mL | 6.03 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
