Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
| Discription | Kinetin is a kind of cytokinin, a class of plant hormone that promotes cell division. |
|---|
| Catalog Num | A10503 |
|---|---|
| Formula | C10H9N5O |
| Molecular Weight | 215.2 |
| CAS Number | 525-79-1 |
| SMILES | C1=COC(=C1)CNC2=NC=NC3=C2NC=N3 |
| Synonyms | 6-Furfuryladenine, N6-Furfuryladenine, 6-Furfurylaminopurine,Cytokinin |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | Warmed: 8 mg/mL (37.17 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 46.47 mL | 232.34 mL | 464.68 mL |
| 0.5 mM | 9.29 mL | 46.47 mL | 92.94 mL |
| 1 mM | 4.65 mL | 23.23 mL | 46.47 mL |
| 5 mM | 0.93 mL | 4.65 mL | 9.29 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
