Loading distributor info...
| Description | KNK437, dose-dependently inhibited the acquisition of thermotolerance and the induction of various HSPs including HSP105, HSP70, and HSP40 in COLO 320DM (human colon carcinoma) cells. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A14389 |
|---|---|
| Formula | C13H11NO4 |
| Molecular Weight | 245.23 |
| CAS Number | 218924-25-5 |
| SMILES | O=CN1C(/C(CC1)=C\C2=CC=C(OCO3)C3=C2)=O |
| Synonyms | KNK-437, KNK 437 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | Warmed: 14 mg/mL (57.08 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+corn oil | 1 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 40.78 mL | 203.89 mL | 407.78 mL |
| 0.5 mM | 8.16 mL | 40.78 mL | 81.56 mL |
| 1 mM | 4.08 mL | 20.39 mL | 40.78 mL |
| 5 mM | 0.82 mL | 4.08 mL | 8.16 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
