Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | KO-947 is a potent and selective inhibitor of ERK1/2 kinases with potential clinical utility in MAPK pathway dysregulated tumors. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19903 |
|---|---|
| Formula | C21H17N5O |
| Molecular Weight | 355.39 |
| CAS Number | 1695533-89-1 |
| SMILES | O=C1NC2=CC(NN=C3C4=CC=NC=C4)=C3C=C2CN1CC5=CC=CC=C5 |
| Synonyms | KO947, KO 947 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 62 mg/mL (174.46 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 28.14 mL | 140.69 mL | 281.38 mL |
| 0.5 mM | 5.63 mL | 28.14 mL | 56.28 mL |
| 1 mM | 2.81 mL | 14.07 mL | 28.14 mL |
| 5 mM | 0.56 mL | 2.81 mL | 5.63 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
