Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | KPT-330 inhibitor of CRM1 (XPO1)-mediated nuclear export has selective anti-leukaemic activity in preclinical models of T-cell acute lymphoblastic leukaemia and acute myeloid leukaemia. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12582 |
|---|---|
| Formula | C17H11F6N7O |
| Molecular Weight | 443.31 |
| CAS Number | 1393477-72-9 |
| SMILES | C1=CN=C(C=N1)NNC(=O)/C=C\N2C=NC(=N2)C3=CC(=CC(=C3)C(F)(F)F)C(F)(F)F |
| Synonyms | KPT330, KPT 330 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 78 mg/mL (175.94 mM) | |
| Water | Insoluble | ||
| Ethanol | 36 mg/mL (81.21 mM) | ||
| In vivo | 2% DMSO+40%PEG 300+5% Tween80 +ddH2O | 3 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 22.56 mL | 112.79 mL | 225.58 mL |
| 0.5 mM | 4.51 mL | 22.56 mL | 45.12 mL |
| 1 mM | 2.26 mL | 11.28 mL | 22.56 mL |
| 5 mM | 0.45 mL | 2.26 mL | 4.51 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
