Loading distributor info...
| Description | L-Kynurenine is a metabolite of the amino acid L-tryptophan. L-Kynurenine is an aryl hydrocarbon receptor agonist. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19603 |
|---|---|
| Formula | C10H12N2O3 |
| Molecular Weight | 208.21 |
| CAS Number | 2922-83-0 |
| SMILES | O=C(O)[C@@H](N)CC(C1=CC=CC=C1N)=O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 39 mg/mL (187.3 mM) | |
| Water | 3 mg/mL (14.4 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 48.03 mL | 240.14 mL | 480.28 mL |
| 0.5 mM | 9.61 mL | 48.03 mL | 96.06 mL |
| 1 mM | 4.8 mL | 24.01 mL | 48.03 mL |
| 5 mM | 0.96 mL | 4.8 mL | 9.61 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
