Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Lansoprazole(AG 1749) is a proton pump inhibitor which prevents the stomach from producing acid. |
|---|
| Catalog Num | A10513 |
|---|---|
| Formula | C16H14F3N3O2S |
| Molecular Weight | 369.36 |
| CAS Number | 103577-45-3 |
| SMILES | O=S(C1=NC2=CC=CC=C2N1)CC3=NC=CC(OCC(F)(F)F)=C3C |
| Synonyms | AG-1749 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 64 mg/mL (173.27 mM) | |
| Water | Insoluble | ||
| Ethanol | 12 mg/mL (32.49 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.07 mL | 135.37 mL | 270.74 mL |
| 0.5 mM | 5.41 mL | 27.07 mL | 54.15 mL |
| 1 mM | 2.71 mL | 13.54 mL | 27.07 mL |
| 5 mM | 0.54 mL | 2.71 mL | 5.41 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
