Loading distributor info...
| Description | Osilodrostat (LCI699) is a potent inhibitor of human 11β-hydroxylase and aldosterone synthase with IC50 values of 2.5 and 0.7 nM, respectively. | |||||
|---|---|---|---|---|---|---|
| Cell Research |
|
| Catalog Num | A14013 |
|---|---|
| Formula | C13H10FN3 |
| Molecular Weight | 227.241 |
| CAS Number | 928134-65-0 |
| SMILES | C1CC2=CN=CN2[C@H]1C3=C(C=C(C=C3)C#N)F |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 43 mg/mL (189.22 mM) | |
| Water | 14 mg/mL (61.6 mM) | ||
| Ethanol | 43 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 44.01 mL | 220.03 mL | 440.06 mL |
| 0.5 mM | 8.8 mL | 44.01 mL | 88.01 mL |
| 1 mM | 4.4 mL | 22 mL | 44.01 mL |
| 5 mM | 0.88 mL | 4.4 mL | 8.8 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
