Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Lentinan is an intravenous anti-tumor polysaccharide and one of the host-mediated anti-cancer drugs which has been shown to affect host defense immune systems. |
|---|
| Catalog Num | A17518 |
|---|---|
| Formula | C42H72O36 |
| Molecular Weight | 1153 |
| CAS Number | 37339-90-5 |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)O)O)O[C@H]3[C@@H]([C@H]([C@@H]([C@H](O3)CO)O)O[C@H]4[C@@H]([C@H]([C@@H]([C@H](O4)CO)O)O[C@H]5[C@@H]([C@H]([C@@H]([C@H](O5)CO[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O)O)O[C@H]7[C@@H]([C@H]([C@@H]([C@H](O7)CO)O)O)O)O)O)O)O)O)O)O)O |
| Synonyms | Lentinan; A823605; Bromoduline; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 92 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 8.67 mL | 43.37 mL | 86.73 mL |
| 0.5 mM | 1.73 mL | 8.67 mL | 17.35 mL |
| 1 mM | 0.87 mL | 4.34 mL | 8.67 mL |
| 5 mM | 0.17 mL | 0.87 mL | 1.73 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
