Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Lersivirine (UK-453,061) is a next-generation nonnucleoside reverse transcriptase inhibitor, active against wild-type HIV-1 and several nonnucleoside reverse transcriptase inhibitor-resistant strains. |
|---|
| Catalog Num | A12667 |
|---|---|
| Formula | C17H18N4O2 |
| Molecular Weight | 310.35 |
| CAS Number | 473921-12-9 |
| SMILES | CCC1=C(C(=NN1CCO)CC)OC2=CC(=CC(=C2)C#N)C#N |
| Synonyms | UK 453061, UK453061 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 53 mg/mL | |
| Water | Insoluble | ||
| Ethanol | 53 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 32.22 mL | 161.11 mL | 322.22 mL |
| 0.5 mM | 6.44 mL | 32.22 mL | 64.44 mL |
| 1 mM | 3.22 mL | 16.11 mL | 32.22 mL |
| 5 mM | 0.64 mL | 3.22 mL | 6.44 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
