Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Levosimendan is a Ca2+ sensitizer that increases contractile force of the myocardium by enhancing the sensitivity of myofilaments to calcium without increasing intracellular calcium concentration. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11874 |
|---|---|
| Formula | C14H12N6O |
| Molecular Weight | 280.29 |
| CAS Number | 141505-33-1 |
| SMILES | C[C@@H]1CC(=O)NN=C1C2=CC=C(C=C2)NN=C(C#N)C#N |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 48 mg/mL (171.26 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| In vivo | 5% DMSO+40%PEG 300+5%Tween80+50%ddH2O | 4 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 35.68 mL | 178.39 mL | 356.77 mL |
| 0.5 mM | 7.14 mL | 35.68 mL | 71.35 mL |
| 1 mM | 3.57 mL | 17.84 mL | 35.68 mL |
| 5 mM | 0.71 mL | 3.57 mL | 7.14 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
