Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LGX818 is an orally available Raf kinase inhibitor with potential antineoplastic activity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13226 |
|---|---|
| Formula | C22H27ClFN7O4S |
| Molecular Weight | 540.01 |
| CAS Number | 1269440-17-6, 1269440-29-0 |
| SMILES | C[C@@H](CNC1=NC=CC(=N1)C2=CN(N=C2C3=CC(=CC(=C3F)NS(=O)(=O)C)Cl)C(C)C)NC(=O)OC |
| Synonyms | LGX818, LGX-818 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 93 mg/mL (172.22 mM) | |
| Water | Insoluble | ||
| Ethanol | 93 mg/mL (172.22 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 18.52 mL | 92.59 mL | 185.18 mL |
| 0.5 mM | 3.7 mL | 18.52 mL | 37.04 mL |
| 1 mM | 1.85 mL | 9.26 mL | 18.52 mL |
| 5 mM | 0.37 mL | 1.85 mL | 3.7 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
