Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Lifitegrast (SAR 1118) is an integrin lymphocyte function-associated antigen-1 (LFA-1) antagonist; inhibits Jurkat T cell attachment to ICAM-1 with an IC50 of 2.98 nM. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17299 |
|---|---|
| Formula | C29H24Cl2N2O7S |
| Molecular Weight | 615.478 |
| CAS Number | 1025967-78-5 |
| SMILES | O=C(O)[C@@H](NC(C1=C(Cl)C2=C(CN(C(C3=CC=C4C=COC4=C3)=O)CC2)C=C1Cl)=O)CC5=CC=CC(S(=O)(C)=O)=C5 |
| Synonyms | SAR-1118; SAR 1118; SAR1118; Lifitegrast, brand name: Xiidra. |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 98 mg/mL (159.22 mM) | |
| Water | Insoluble | ||
| Ethanol | 20 mg/mL | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 16.25 mL | 81.24 mL | 162.48 mL |
| 0.5 mM | 3.25 mL | 16.25 mL | 32.5 mL |
| 1 mM | 1.62 mL | 8.12 mL | 16.25 mL |
| 5 mM | 0.32 mL | 1.62 mL | 3.25 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
