Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LM22B-10 is an activator of TrkB/TrkC neurotrophin receptor, and can induce TrkB, TrkC, AKT and ERK activation in vitro and in vivo. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19485 |
|---|---|
| Formula | C27H33ClN2O4 |
| Molecular Weight | 485.01 |
| CAS Number | 342777-54-2 |
| SMILES | ClC1=CC=C(C(C2=CC=C(N(CCO)CCO)C=C2)C3=CC=C(N(CCO)CCO)C=C3)C=C1 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 82 mg/mL (169.06 mM) | |
| Water | Insoluble | ||
| Ethanol | 82 mg/mL (169.06 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.62 mL | 103.09 mL | 206.18 mL |
| 0.5 mM | 4.12 mL | 20.62 mL | 41.24 mL |
| 1 mM | 2.06 mL | 10.31 mL | 20.62 mL |
| 5 mM | 0.41 mL | 2.06 mL | 4.12 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
