Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Losartan is an angiotensin II receptor antagonist, competing with the binding of angiotensin II to AT1 receptors with IC50 of 20 nM. |
|---|
| Catalog Num | A17510 |
|---|---|
| Formula | C22H23ClN6O |
| Molecular Weight | 422.91 |
| CAS Number | 114798-26-4 |
| SMILES | OCC1=C(Cl)N=C(CCCC)N1CC2=CC=C(C3=CC=CC=C3C4=NNN=N4)C=C2 |
| Synonyms | Losartan; DUP 89; DUP-89; DUP89; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 76 mg/mL (179.7 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.65 mL | 118.23 mL | 236.46 mL |
| 0.5 mM | 4.73 mL | 23.65 mL | 47.29 mL |
| 1 mM | 2.36 mL | 11.82 mL | 23.65 mL |
| 5 mM | 0.47 mL | 2.36 mL | 4.73 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
