Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LTURM34 is a specific DNA-PK inhibitor (IC50=34 nM). LTURM34 exhibits 170-fold selectivity for DNA-PK over PI3K. LTURM34 shows potent antiproliferative activity in a wide range of tumor cell lines. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19994 |
|---|---|
| Formula | C24H18N2O3S |
| Molecular Weight | 414.48 |
| CAS Number | 1879887-96-3 |
| SMILES | O=C1C2=CC=CC(C3=CC=CC4=C3SC5=C4C=CC=C5)=C2OC(N6CCOCC6)=N1 |
| Synonyms | LTURM 34, LTURM-34 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 81 mg/mL (195.42 mM) | |
| Water | Insoluble | ||
| Ethanol | 4 mg/mL (9.65 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 24.13 mL | 120.63 mL | 241.27 mL |
| 0.5 mM | 4.83 mL | 24.13 mL | 48.25 mL |
| 1 mM | 2.41 mL | 12.06 mL | 24.13 mL |
| 5 mM | 0.48 mL | 2.41 mL | 4.83 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
