Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LXR-623 is a brain-penetrant partial LXRα and full LXRβ agonist, with IC50s of 24 nM and 179 nM, respectively. |
|---|
| Catalog Num | A21366 |
|---|---|
| Formula | C21H12ClF5N2 |
| Molecular Weight | 422.78 |
| CAS Number | 875787-07-8 |
| SMILES | ClC1=C(CN2N=C(C(C(F)(F)F)=CC=C3)C3=C2C4=CC=C(F)C=C4)C=CC(F)=C1 |
| Synonyms | WAY 252623, WAY-252623, WAY252623, LXR623, LXR 623 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 76 mg/mL (179.76 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 76 mg/mL (179.76 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 23.65 mL | 118.26 mL | 236.53 mL |
| 0.5 mM | 4.73 mL | 23.65 mL | 47.31 mL |
| 1 mM | 2.37 mL | 11.83 mL | 23.65 mL |
| 5 mM | 0.47 mL | 2.37 mL | 4.73 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
