Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | LY255283 is a LTB4 receptor (BLT2) antagonist, with an IC50 of ~100 nM for [3H]LTB4 binding to guinea pig lung membranes. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13090 |
|---|---|
| Formula | C19H28N4O3 |
| Molecular Weight | 360.46 |
| CAS Number | 117690-79-6 |
| SMILES | CCC1=C(C=C(C(=C1)C(=O)C)O)OCCCCCC(C)(C)C2=NNN=N2 |
| Synonyms | LY255283, LY-255283 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 68 mg/mL (188.65 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 27.74 mL | 138.71 mL | 277.42 mL |
| 0.5 mM | 5.55 mL | 27.74 mL | 55.48 mL |
| 1 mM | 2.77 mL | 13.87 mL | 27.74 mL |
| 5 mM | 0.55 mL | 2.77 mL | 5.55 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
