Signaling Pathway
Product type
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | LY2090314 is a potent inhibitor of glycogen synthase kinase-3 (GSK-3) which plays an important role in many pathways, including initiation of protein synthesis, cell proliferation, cell differentiation, and apoptosis. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12741 |
|---|---|
| Formula | C28H25FN6O3 |
| Molecular Weight | 512.53 |
| CAS Number | 603288-22-8 |
| SMILES | C1CCN(CC1)C(=O)N2CCN3C=C(C4=CC(=CC(=C43)C2)F)C5=C(C(=O)NC5=O)C6=CN=C7N6C=CC=C7 |
| Synonyms | LY 2090314, LY-2090314 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 93 mg/mL (181.45 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 2 mg/mL (3.9 mM) | ||
| In vivo | 5% DMSO+45% PEG 300+ddH2O | 16 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 19.51 mL | 97.56 mL | 195.11 mL |
| 0.5 mM | 3.9 mL | 19.51 mL | 39.02 mL |
| 1 mM | 1.95 mL | 9.76 mL | 19.51 mL |
| 5 mM | 0.39 mL | 1.95 mL | 3.9 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
