Loading distributor info...
| Description | M1001 is a weak agonist of HIF-2α, directly binds to the HIF-2α PAS-B domain, with a Kd of 667 nM. M1001 enhances the stabilities of HIF-2α-ARNT complex. |
|---|
| Catalog Num | A19443 |
|---|---|
| Formula | C17H17N3O2S |
| Molecular Weight | 327.4 |
| CAS Number | 874590-32-6 |
| SMILES | O=S1(C2=C(C=CC=C2)C(NC3=C(N4CCCC4)C=CC=C3)=N1)=O |
| Synonyms | M 1001; M-1001 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 62 mg/mL (189.37 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.54 mL | 152.72 mL | 305.44 mL |
| 0.5 mM | 6.11 mL | 30.54 mL | 61.09 mL |
| 1 mM | 3.05 mL | 15.27 mL | 30.54 mL |
| 5 mM | 0.61 mL | 3.05 mL | 6.11 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
