Loading distributor info...
| Description | Meclofenoxate HCl is an anti-aging drug used to treat the symptoms of senile dementia and Alzheimer's disease, and also inhibits the activity of cholinephosphotransferase. |
|---|
| Catalog Num | A14265 |
|---|---|
| Formula | C12H17Cl2NO3 |
| Molecular Weight | 294.17 |
| CAS Number | 3685-84-5 |
| SMILES | CN(C)CCOC(=O)COC1=CC=C(C=C1)Cl.Cl |
| Synonyms | Centrophenoxine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 51 mg/mL (173.36 mM) | |
| Water | 51 mg/mL (173.36 mM) | ||
| Ethanol | 51 mg/mL (173.36 mM) | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 33.99 mL | 169.97 mL | 339.94 mL |
| 0.5 mM | 6.8 mL | 33.99 mL | 67.99 mL |
| 1 mM | 3.4 mL | 17 mL | 33.99 mL |
| 5 mM | 0.68 mL | 3.4 mL | 6.8 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
