Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Medetomidine Hydrochloride is an adrenergic alpha-2 receptor agonist, which is used in veterinary medicine for its analgesic and sedative properties. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13775 |
|---|---|
| Formula | C13H16N2.HCl |
| Molecular Weight | 236.74 |
| CAS Number | 86347-15-1 |
| SMILES | CC1=C(C(=CC=C1)C(C)C2=CN=CN2)C.Cl |
| Synonyms | MonoHydrochloride, Domitor, MPV 785, Metomidine, Zalopine, Detomidine HCl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 12 mg/mL (50.68 mM) | |
| Water | 45 mg/mL (190.08 mM) | ||
| Ethanol | 45 mg/mL (190.08 mM) | ||
| In vivo | Saline | 28 mg/mL | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 42.24 mL | 211.2 mL | 422.4 mL |
| 0.5 mM | 8.45 mL | 42.24 mL | 84.48 mL |
| 1 mM | 4.22 mL | 21.12 mL | 42.24 mL |
| 5 mM | 0.84 mL | 4.22 mL | 8.45 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
