Loading distributor info...
| Description | Melitracen HCl ia potential dopamine D1/2 receptor antagonist used to treat depression. It is often co-administered with flupenthixol as a treatment for trigeminal neuralgia. It does not effect cardiovascular function. |
|---|
| Catalog Num | A17494 |
|---|---|
| Formula | C21H26ClN |
| Molecular Weight | 327.89 |
| CAS Number | 10563-70-9 |
| SMILES | CC(C1=C/2C=CC=C1)(C)C3=CC=CC=C3C2=C/CCN(C)C.[H]Cl |
| Synonyms | N 7001; N7001; N-7001; Melitracen HCl |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 56 mg/mL (170.78 mM) | |
| Water | 56 mg/mL (170.78 mM) | ||
| Ethanol | 56 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 30.5 mL | 152.49 mL | 304.98 mL |
| 0.5 mM | 6.1 mL | 30.5 mL | 61 mL |
| 1 mM | 3.05 mL | 15.25 mL | 30.5 mL |
| 5 mM | 0.61 mL | 3.05 mL | 6.1 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
