Loading distributor info...
| Description | MHP (Methyl caprooyl tyrosinate) is an activator of sphingosine kinase (SPHK1), and significantly stimulates CAMP mRNA and protein production. MHP (Methyl caprooyl tyrosinate) enhances antimicrobial defense and innate immunity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A19401 |
|---|---|
| Formula | C16H23NO4 |
| Molecular Weight | 293.36 |
| CAS Number | 1104874-94-3 |
| SMILES | OC(C=C1)=CC=C1C[C@@H](C(OC)=O)NC(CCCCC)=O |
| Synonyms | Methyl caprooyl tyrosinate |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 97 mg/mL (330.64 mM) | |
| Water | 97 mg/mL (330.64 mM) | ||
| Ethanol | Insoluble | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.09 mL | 170.44 mL | 340.88 mL |
| 0.5 mM | 6.82 mL | 34.09 mL | 68.18 mL |
| 1 mM | 3.41 mL | 17.04 mL | 34.09 mL |
| 5 mM | 0.68 mL | 3.41 mL | 6.82 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
