Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MHY1485 is a mTOR activator; inhibits the autophagic process by inhibition of fusion between autophagosomes and lysosomes leading to the accumulation of LC3II protein and enlarged autophagosomes. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A15508 |
|---|---|
| Formula | C17H21N7O4 |
| Molecular Weight | 387.39 |
| CAS Number | 326914-06-1 |
| SMILES | C1COCCN1C2=NC(=NC(=N2)NC3=CC=C(C=C3)[N+](=O)[O-])N4CCOCC4 |
| Synonyms | MHY 1485, MHY-1485 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 4 mg/mL (10.32 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 25.81 mL | 129.07 mL | 258.14 mL |
| 0.5 mM | 5.16 mL | 25.81 mL | 51.63 mL |
| 1 mM | 2.58 mL | 12.91 mL | 25.81 mL |
| 5 mM | 0.52 mL | 2.58 mL | 5.16 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
