Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MI-463 is a highly potent and orally bioavailable small molecule inhibitor of the menin-mLL interaction. |
|---|
| Catalog Num | A20755 |
|---|---|
| Formula | C24H23F3N6S |
| Molecular Weight | 484.54 |
| CAS Number | 1628317-18-9 |
| SMILES | FC(F)(F)CC(S1)=CC2=C1N=CN=C2NC3CCN(CC4=CC=C(NC(C#N)=C5)C5=C4C)CC3 |
| Synonyms | MI 463; MI463 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 84 mg/mL (173.36 mM) | |
| Water | Insoluble | ||
| Ethanol | 19 mg/mL (39.21 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.64 mL | 103.19 mL | 206.38 mL |
| 0.5 mM | 4.13 mL | 20.64 mL | 41.28 mL |
| 1 mM | 2.06 mL | 10.32 mL | 20.64 mL |
| 5 mM | 0.41 mL | 2.06 mL | 4.13 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
