Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Midodrine is an ethanolamine derivative that is an adrenergic alpha-1 agonist. It is used as a vasoconstrictor agent in the treatment of HYPOTENSION. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A17758 |
|---|---|
| Formula | C12H18N2O4 |
| Molecular Weight | 254.29 |
| CAS Number | 42794-76-3 |
| SMILES | O=C(NCC(C1=CC(OC)=CC=C1OC)O)CN |
| Synonyms | Midodrine, St 1085 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 45 mg/mL (176.96 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 39.33 mL | 196.63 mL | 393.25 mL |
| 0.5 mM | 7.87 mL | 39.33 mL | 78.65 mL |
| 1 mM | 3.93 mL | 19.66 mL | 39.33 mL |
| 5 mM | 0.79 mL | 3.93 mL | 7.87 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
