Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | MIF antagonist is an inhibitor of the dopachrome tautomerase activity of MIF in vitro (IC50 = 7 M) and in cells (IC50 = 25 M). |
|---|
| Catalog Num | A13631 |
|---|---|
| Formula | C12H13NO4 |
| Molecular Weight | 235.2 |
| CAS Number | 478336-92-4 |
| SMILES | COC(=O)CC1CC(=C2C=CC(=O)C=C2)NO1 |
| Synonyms | Macrophage, ISO-1, Macrophage Migration Inhibitory Factor |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 44 mg/mL (187.04 mM) | |
| Water | Insoluble | ||
| Ethanol | 44 mg/mL (187.04 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 42.52 mL | 212.59 mL | 425.17 mL |
| 0.5 mM | 8.5 mL | 42.52 mL | 85.03 mL |
| 1 mM | 4.25 mL | 21.26 mL | 42.52 mL |
| 5 mM | 0.85 mL | 4.25 mL | 8.5 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
