Loading distributor info...
| Description | (-)-MK 801 maleate acts as a potent, selective, and non-competitive NMDA receptor antagonist. It acts by binding to a site located within the NMDA associated ion channel. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A13435 |
|---|---|
| Formula | C20H19NO4 |
| Molecular Weight | 337.37 |
| CAS Number | 121917-57-5 |
| SMILES | C[C@]12C3=CC=CC=C3C[C@H](N1)C4=CC=CC=C24.C(=C/C(=O)O)\C(=O)O |
| Synonyms | MK801, MK-801 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro (25°C) | DMSO | 63 mg/mL (186.73 mM) | |
| Water | Insoluble | ||
| Ethanol | 7 mg/mL (20.74 mM) | ||
| In vivo | 2% DMSO+40% PEG 300+2% Tween 80+ddH2O | 7 mg/mL | |
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 29.64 mL | 148.21 mL | 296.41 mL |
| 0.5 mM | 5.93 mL | 29.64 mL | 59.28 mL |
| 1 mM | 2.96 mL | 14.82 mL | 29.64 mL |
| 5 mM | 0.59 mL | 2.96 mL | 5.93 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
![(-)-MK 801 maleate [ (-)-Dizocilpine maleate] 121917-57-5 NMDA receptor antagonist.](https://www.adooq.com/media/catalog/product/cache/9222bce87e7def4079ba2ab8616be292/a/1/a13435-maleate.gif)
