Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Mirtazapine is a noradrenergic and specific serotonergic antidepressant (NaSSA) . Structurally, mirtazapine can also be classified as a tetracyclic antidepressant (TeCA). | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11702 |
|---|---|
| Formula | C17H19N3 |
| Molecular Weight | 265.35 |
| CAS Number | 85650-52-8 |
| SMILES | CN1CCN2C(C1)C3=CC=CC=C3CC4=C2N=CC=C4 |
| Synonyms | Remeron, Avanza |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 47 mg/mL (177.12 mM) | |
| Water | Insoluble | ||
| Ethanol | 47 mg/mL (177.12 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 37.69 mL | 188.43 mL | 376.86 mL |
| 0.5 mM | 7.54 mL | 37.69 mL | 75.37 mL |
| 1 mM | 3.77 mL | 18.84 mL | 37.69 mL |
| 5 mM | 0.75 mL | 3.77 mL | 7.54 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
