Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Mivebresib, also known as ABBV-075, is a potent BET inhibitor (bromodomain (BRD)-containing proteind) with potential antineoplastic activity. |
|---|
| Catalog Num | A17226 |
|---|---|
| Formula | C22H19F2N3O4S |
| Molecular Weight | 459.4678 |
| CAS Number | 1445993-26-9 |
| SMILES | CCS(=O)(NC1=CC=C(OC2=CC=C(F)C=C2F)C(C3=CN(C)C(C4=C3C=CN4)=O)=C1)=O |
| Synonyms | ABBV-075; ABBV 075; ABBV075; |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 79 mg/mL (171.93 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 21.76 mL | 108.82 mL | 217.64 mL |
| 0.5 mM | 4.35 mL | 21.76 mL | 43.53 mL |
| 1 mM | 2.18 mL | 10.88 mL | 21.76 mL |
| 5 mM | 0.44 mL | 2.18 mL | 4.35 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
