Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Loading distributor info...
| Discription | MLN0905 is a potent, selective small-molecule PLK1 inhibitor. MLN0905 inhibits cell proliferation in a broad range of human tumor cells including DLBCL cell lines. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A12429 |
|---|---|
| Formula | C24H25F3N6S |
| Molecular Weight | 486.56 |
| CAS Number | 1228960-69-7 |
| SMILES | CC1=C(C=C(C=N1)CCCN(C)C)NC2=NC=C3CC(=S)NC4=C(C3=N2)C=CC(=C4)C(F)(F)F |
| Synonyms | MLN-0905,MLN0905 |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 93 mg/mL (191.13 mM) | |
| Water | Insoluble | ||
| Ethanol | Insoluble | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 20.55 mL | 102.76 mL | 205.52 mL |
| 0.5 mM | 4.11 mL | 20.55 mL | 41.1 mL |
| 1 mM | 2.06 mL | 10.28 mL | 20.55 mL |
| 5 mM | 0.41 mL | 2.06 mL | 4.11 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
