Loading distributor info...
| Description | Molsidomine is an orally active, long acting vasodilating drug. Molsidomine is metabolized in the liver to the active metabolite linsidomine. |
|---|
| Catalog Num | A16136 |
|---|---|
| Formula | C9H14N4O4 |
| Molecular Weight | 242.23 |
| CAS Number | 25717-80-0 |
| SMILES | CCOC(=NC1=C[N+](=NO1)N2CCOCC2)[O-] |
| Synonyms | SIN-10, Corvaton, Morsydomine |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 43 mg/mL (177.51 mM) | |
| Water | 8 mg/mL (33.02 mM) | ||
| Ethanol | 43 mg/mL | ||
| * <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. | |||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 41.28 mL | 206.42 mL | 412.83 mL |
| 0.5 mM | 8.26 mL | 41.28 mL | 82.57 mL |
| 1 mM | 4.13 mL | 20.64 mL | 41.28 mL |
| 5 mM | 0.83 mL | 4.13 mL | 8.26 mL |
This calculator helps you calculate mass of compound based on solution concentration, volume and molecular weight in a specific solution using the formula:
Mass (mg) = Concentration (mM) × Volume (mL) × Molecular Weight (g/mol)
Please check COA/MSDS for correct molecular weight.
Calculate the dilution required to prepare a stock solution.This equation is commonly abbreviated as: C1V1 = C2V2
