Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Monastrol is a potent, cell permeable non-tubulin-interacting mitosis inhibitor. Monastrol blocks mitosis (IC5N/A = 14 μM) by binding to the mitotic kinesin Eg5, a motor protein required for spindle bipolarity. | ||
|---|---|---|---|
| Targets |
|
| Catalog Num | A11976 |
|---|---|
| Formula | C14H16N2O3S |
| Molecular Weight | 292.4 |
| CAS Number | 329689-23-8 |
| SMILES | CCOC(=O)C1=C(NC(=S)NC1C2=CC(=CC=C2)O)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 54 mg/mL (184.71 mM) | |
| Water | Insoluble | ||
| Ethanol | 54 mg/mL (184.71 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 34.2 mL | 171 mL | 342 mL |
| 0.5 mM | 6.84 mL | 34.2 mL | 68.4 mL |
| 1 mM | 3.42 mL | 17.1 mL | 34.2 mL |
| 5 mM | 0.68 mL | 3.42 mL | 6.84 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
