Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Morin hydrate is a chemical compound. Morin can be used to test for the presence of aluminum or tin in a solution, since it forms characteristically fluorescent coordination complexes with them. |
|---|
| Catalog Num | A10605 |
|---|---|
| Formula | C15H12O8 |
| Molecular Weight | 320.3 |
| CAS Number | 6202-27-3 |
| SMILES | C1=CC(=C(C=C1O)O)C2=C(C(=O)C3=C(C=C(C=C3O2)O)O)O.O |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 54 mg/mL (168.62 mM) | |
| Water | Insoluble | ||
| Ethanol | Warmed: 2 mg/mL (6.24 mM) | ||
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 31.22 mL | 156.1 mL | 312.21 mL |
| 0.5 mM | 6.24 mL | 31.22 mL | 62.44 mL |
| 1 mM | 3.12 mL | 15.61 mL | 31.22 mL |
| 5 mM | 0.62 mL | 3.12 mL | 6.24 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
