Signaling Pathway
Important Notice: For research use only. We do not sell to patients.
Not your Region? View all Distributors
| Discription | Nardosinone is a sesquiterpene and chemical constituent of Nardostachys jatamansi. |
|---|
| Catalog Num | A14691 |
|---|---|
| Formula | C15H22O3 |
| Molecular Weight | 250.33 |
| CAS Number | 23720-80-1 |
| SMILES | CC1CCC=C2C1(C3C(CC2=O)OOC3(C)C)C |
| Storage | Store lyophilized at -20ºC, keep desiccated. |
| In vitro | DMSO | 50 mg/mL (199.73 mM) | |
|
* <1 mg/ml means slightly soluble or insoluble. * Please note that Adooq tests the solubility of all compounds in-house, and the actual solubility may differ slightly from published values. This is normal and is due to slight batch-to-batch variations. |
|||
| Concentration / Solvent Volume / Mass | 1 mg | 5 mg | 10 mg |
|---|---|---|---|
| 0.1 mM | 39.95 mL | 199.74 mL | 399.47 mL |
| 0.5 mM | 7.99 mL | 39.95 mL | 79.89 mL |
| 1 mM | 3.99 mL | 19.97 mL | 39.95 mL |
| 5 mM | 0.8 mL | 3.99 mL | 7.99 mL |
Calculate the dilution required to prepare a stock solution. This equation is commonly abbreviated as: C1V1 = C2V2
